C14H26N2 — CID 146593809
N-propyl-N'-[(3Z)-2,2,6-trimethylhepta-3,5-dienyl]methanimidamide (PubChem CID 146593809) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is N-propyl-N'-[(3Z)-2,2,6-trimethylhepta-3,5-dienyl]methanimidamide.
| Compound Name | N-propyl-N'-[(3Z)-2,2,6-trimethylhepta-3,5-dienyl]methanimidamide |
|---|---|
| PubChem CID | 146593809 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | N-propyl-N'-[(3Z)-2,2,6-trimethylhepta-3,5-dienyl]methanimidamide |
| SMILES | CCCN/C=N/CC(C)(C)/C=C\C=C(C)C |
| InChI | InChI=1S/C14H26N2/c1-6-10-15-12-16-11-14(4,5)9-7-8-13(2)3/h7-9,12H,6,10-11H2,1-5H3,(H,15,16)/b9-7- |
| InChIKey | SBVCNJLUAYIXRA-CLFYSBASSA-N |
| XLogP | 3.56 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|