About 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole
1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole (PubChem CID 146593814) has the molecular formula C11H13F3N2
and a molecular weight of 230.23 g/mol. Its IUPAC name is 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole |
| PubChem CID | 146593814 |
| Molecular Formula | C11H13F3N2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole |
| SMILES | CCCn1cnc2c1=CC(C(F)(F)F)CC=2 |
| InChI | InChI=1S/C11H13F3N2/c1-2-5-16-7-15-9-4-3-8(6-10(9)16)11(12,13)14/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | NQUKWQYCQSKWNP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole?
The IUPAC name of 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole (CID 146593814) is 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole.
What is the SMILES notation for 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole?
The canonical SMILES for 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole is CCCn1cnc2c1=CC(C(F)(F)F)CC=2.
What is the InChIKey of 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole?
The InChIKey is NQUKWQYCQSKWNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3N2/c1-2-5-16-7-15-9-4-3-8(6-10(9)16)11(12,13)14/h4,6-8H,2-3,5H2,1H3.
What are the key properties of 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole?
1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole has a molecular weight of 230.23 g/mol, XLogP of 1.44, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propyl-6-(trifluoromethyl)-5,6-dihydrobenzimidazole is sourced from PubChem (CID 146593814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).