About 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile
1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile (PubChem CID 146594051) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile.
Molecular Properties
| Compound Name | 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile |
| PubChem CID | 146594051 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile |
| SMILES | C=CCN1C=NC2=CC(C#N)=CCC21 |
| InChI | InChI=1S/C11H11N3/c1-2-5-14-8-13-10-6-9(7-12)3-4-11(10)14/h2-3,6,8,11H,1,4-5H2 |
| InChIKey | HMJQTWHDXKLMSS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 39.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile?
The IUPAC name of 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile (CID 146594051) is 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile.
What is the SMILES notation for 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile?
The canonical SMILES for 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile is C=CCN1C=NC2=CC(C#N)=CCC21.
What is the InChIKey of 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile?
The InChIKey is HMJQTWHDXKLMSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c1-2-5-14-8-13-10-6-9(7-12)3-4-11(10)14/h2-3,6,8,11H,1,4-5H2.
What are the key properties of 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile?
1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile has a molecular weight of 185.23 g/mol, XLogP of 1.62, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-prop-2-enyl-7,7a-dihydrobenzimidazole-5-carbonitrile is sourced from PubChem (CID 146594051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).