About 1-ethyl-3a,4-dihydrobenzotriazol-5-amine
1-ethyl-3a,4-dihydrobenzotriazol-5-amine (PubChem CID 146594071) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-ethyl-3a,4-dihydrobenzotriazol-5-amine.
Molecular Properties
| Compound Name | 1-ethyl-3a,4-dihydrobenzotriazol-5-amine |
| PubChem CID | 146594071 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1-ethyl-3a,4-dihydrobenzotriazol-5-amine |
| SMILES | CCN1N=NC2CC(N)=CC=C21 |
| InChI | InChI=1S/C8H12N4/c1-2-12-8-4-3-6(9)5-7(8)10-11-12/h3-4,7H,2,5,9H2,1H3 |
| InChIKey | MQSOVSWOTXDJIQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 53.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethyl-3a,4-dihydrobenzotriazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-3a,4-dihydrobenzotriazol-5-amine?
The IUPAC name of 1-ethyl-3a,4-dihydrobenzotriazol-5-amine (CID 146594071) is 1-ethyl-3a,4-dihydrobenzotriazol-5-amine.
What is the SMILES notation for 1-ethyl-3a,4-dihydrobenzotriazol-5-amine?
The canonical SMILES for 1-ethyl-3a,4-dihydrobenzotriazol-5-amine is CCN1N=NC2CC(N)=CC=C21.
What is the InChIKey of 1-ethyl-3a,4-dihydrobenzotriazol-5-amine?
The InChIKey is MQSOVSWOTXDJIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-2-12-8-4-3-6(9)5-7(8)10-11-12/h3-4,7H,2,5,9H2,1H3.
What are the key properties of 1-ethyl-3a,4-dihydrobenzotriazol-5-amine?
1-ethyl-3a,4-dihydrobenzotriazol-5-amine has a molecular weight of 164.21 g/mol, XLogP of 1.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-3a,4-dihydrobenzotriazol-5-amine is sourced from PubChem (CID 146594071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).