C32H18N4O8 — CID 146594592
2,5-bis(1,2,3,4-tetrahydroxycarbazol-9-yl)benzene-1,4-dicarbonitrile (PubChem CID 146594592) has the molecular formula C32H18N4O8 and a molecular weight of 586.52 g/mol. Its IUPAC name is 2,5-bis(1,2,3,4-tetrahydroxycarbazol-9-yl)benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis(1,2,3,4-tetrahydroxycarbazol-9-yl)benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 146594592 |
| Molecular Formula | C32H18N4O8 |
| Molecular Weight | 586.52 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | 2,5-bis(1,2,3,4-tetrahydroxycarbazol-9-yl)benzene-1,4-dicarbonitrile |
| SMILES | N#Cc1cc(-n2c3ccccc3c3c(O)c(O)c(O)c(O)c32)c(C#N)cc1-n1c2ccccc2c2c(O)c(O)c(O)c(O)c21 |
| InChI | InChI=1S/C32H18N4O8/c33-11-13-10-20(36-18-8-4-2-6-16(18)22-24(36)28(40)32(44)30(42)26(22)38)14(12-34)9-19(13)35-17-7-3-1-5-15(17)21-23(35)27(39)31(43)29(41)25(21)37/h1-10,37-44H |
| InChIKey | RRAYGFVXNWTLFE-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 219.28 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|