About (2Z)-1-(methylamino)penta-2,4-diene-1-thiol
(2Z)-1-(methylamino)penta-2,4-diene-1-thiol (PubChem CID 146595129) has the molecular formula C6H11NS
and a molecular weight of 129.23 g/mol. Its IUPAC name is (2Z)-1-(methylamino)penta-2,4-diene-1-thiol.
Molecular Properties
| Compound Name | (2Z)-1-(methylamino)penta-2,4-diene-1-thiol |
| PubChem CID | 146595129 |
| Molecular Formula | C6H11NS |
| Molecular Weight | 129.23 g/mol |
| Exact Mass | 129.06 |
| IUPAC Name | (2Z)-1-(methylamino)penta-2,4-diene-1-thiol |
| SMILES | C=C/C=C\C(S)NC |
| InChI | InChI=1S/C6H11NS/c1-3-4-5-6(8)7-2/h3-8H,1H2,2H3/b5-4- |
| InChIKey | WRMVCBLPBVHELQ-PLNGDYQASA-N |
| XLogP | 1.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-1-(methylamino)penta-2,4-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-1-(methylamino)penta-2,4-diene-1-thiol?
The IUPAC name of (2Z)-1-(methylamino)penta-2,4-diene-1-thiol (CID 146595129) is (2Z)-1-(methylamino)penta-2,4-diene-1-thiol.
What is the SMILES notation for (2Z)-1-(methylamino)penta-2,4-diene-1-thiol?
The canonical SMILES for (2Z)-1-(methylamino)penta-2,4-diene-1-thiol is C=C/C=C\C(S)NC.
What is the InChIKey of (2Z)-1-(methylamino)penta-2,4-diene-1-thiol?
The InChIKey is WRMVCBLPBVHELQ-PLNGDYQASA-N. The full InChI is InChI=1S/C6H11NS/c1-3-4-5-6(8)7-2/h3-8H,1H2,2H3/b5-4-.
What are the key properties of (2Z)-1-(methylamino)penta-2,4-diene-1-thiol?
(2Z)-1-(methylamino)penta-2,4-diene-1-thiol has a molecular weight of 129.23 g/mol, XLogP of 1.20, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-1-(methylamino)penta-2,4-diene-1-thiol is sourced from PubChem (CID 146595129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).