C27H24N2O2S — CID 146595738
(5Z)-3-benzyl-5-[[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 146595738) has the molecular formula C27H24N2O2S and a molecular weight of 440.57 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-benzyl-5-[[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 146595738 |
| Molecular Formula | C27H24N2O2S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | (5Z)-3-benzyl-5-[[4-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(C(=O)N3CCc4ccccc4C3)cc2)SCN1Cc1ccccc1 |
| InChI | InChI=1S/C27H24N2O2S/c30-26(28-15-14-22-8-4-5-9-24(22)18-28)23-12-10-20(11-13-23)16-25-27(31)29(19-32-25)17-21-6-2-1-3-7-21/h1-13,16H,14-15,17-19H2/b25-16- |
| InChIKey | VQGHZFNYIYAVST-XYGWBWBKSA-N |
| XLogP | 4.96 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|