About 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine
1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine (PubChem CID 146595818) has the molecular formula C5H9F2NOS2
and a molecular weight of 201.26 g/mol. Its IUPAC name is 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine.
Molecular Properties
| Compound Name | 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine |
| PubChem CID | 146595818 |
| Molecular Formula | C5H9F2NOS2 |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.01 |
| IUPAC Name | 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine |
| SMILES | FC1(F)CN(CCOSS)C1 |
| InChI | InChI=1S/C5H9F2NOS2/c6-5(7)3-8(4-5)1-2-9-11-10/h10H,1-4H2 |
| InChIKey | ILVKRJOGPOAWSM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine?
The IUPAC name of 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine (CID 146595818) is 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine.
What is the SMILES notation for 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine?
The canonical SMILES for 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine is FC1(F)CN(CCOSS)C1.
What is the InChIKey of 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine?
The InChIKey is ILVKRJOGPOAWSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2NOS2/c6-5(7)3-8(4-5)1-2-9-11-10/h10H,1-4H2.
What are the key properties of 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine?
1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine has a molecular weight of 201.26 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(disulfanyloxy)ethyl]-3,3-difluoroazetidine is sourced from PubChem (CID 146595818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).