C32H37ClN2O6S — CID 146595925
US11130769, Ex. No. 29 (PubChem CID 146595925) has the molecular formula C32H37ClN2O6S and a molecular weight of 613.18 g/mol.
| Compound Name | US11130769, Ex. No. 29 |
|---|---|
| PubChem CID | 146595925 |
| Molecular Formula | C32H37ClN2O6S |
| Molecular Weight | 613.18 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | — |
| SMILES | CO[C@@H]1/C=C/COC2(CC2)C(=O)NS(=O)(=O)c2ccc3c(c2)N(C[C@@H]2CC[C@H]21)C[C@@]1(CCCc2cc(Cl)ccc21)CO3 |
| InChI | InChI=1S/C32H37ClN2O6S/c1-39-28-5-3-15-41-32(13-14-32)30(36)34-42(37,38)24-8-11-29-27(17-24)35(18-22-6-9-25(22)28)19-31(20-40-29)12-2-4-21-16-23(33)7-10-26(21)31/h3,5,7-8,10-11,16-17,22,25,28H,2,4,6,9,12-15,18-20H2,1H3,(H,34,36)/b5-3+/t22-,25+,28+,31-/m0/s1 |
| InChIKey | WLUHTFHEKGUIFK-FAISMICISA-N |
| XLogP | 4.78 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.18 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|