About 3-fluoro-6-methyl-1,2,4,5-tetrazine
3-fluoro-6-methyl-1,2,4,5-tetrazine (PubChem CID 146596395) has the molecular formula C3H3FN4
and a molecular weight of 114.08 g/mol. Its IUPAC name is 3-fluoro-6-methyl-1,2,4,5-tetrazine.
Molecular Properties
| Compound Name | 3-fluoro-6-methyl-1,2,4,5-tetrazine |
| PubChem CID | 146596395 |
| Molecular Formula | C3H3FN4 |
| Molecular Weight | 114.08 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | 3-fluoro-6-methyl-1,2,4,5-tetrazine |
| SMILES | Cc1nnc(F)nn1 |
| InChI | InChI=1S/C3H3FN4/c1-2-5-7-3(4)8-6-2/h1H3 |
| InChIKey | OFXJAFGTPYBDFZ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.08 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-fluoro-6-methyl-1,2,4,5-tetrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-6-methyl-1,2,4,5-tetrazine?
The IUPAC name of 3-fluoro-6-methyl-1,2,4,5-tetrazine (CID 146596395) is 3-fluoro-6-methyl-1,2,4,5-tetrazine.
What is the SMILES notation for 3-fluoro-6-methyl-1,2,4,5-tetrazine?
The canonical SMILES for 3-fluoro-6-methyl-1,2,4,5-tetrazine is Cc1nnc(F)nn1.
What is the InChIKey of 3-fluoro-6-methyl-1,2,4,5-tetrazine?
The InChIKey is OFXJAFGTPYBDFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3FN4/c1-2-5-7-3(4)8-6-2/h1H3.
What are the key properties of 3-fluoro-6-methyl-1,2,4,5-tetrazine?
3-fluoro-6-methyl-1,2,4,5-tetrazine has a molecular weight of 114.08 g/mol, XLogP of -0.29, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-6-methyl-1,2,4,5-tetrazine is sourced from PubChem (CID 146596395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).