C19H32N2O5 — CID 146596751
3-[methyl-[(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamoyl]hex-5-enoic acid (PubChem CID 146596751) has the molecular formula C19H32N2O5 and a molecular weight of 368.47 g/mol. Its IUPAC name is 3-[methyl-[(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamoyl]hex-5-enoic acid.
| Compound Name | 3-[methyl-[(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamoyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 146596751 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 3-[methyl-[(1S,2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamoyl]hex-5-enoic acid |
| SMILES | C=CCC(CC(=O)O)C(=O)N(C)[C@H]1CCCC[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H32N2O5/c1-6-9-13(12-16(22)23)17(24)21(5)15-11-8-7-10-14(15)20-18(25)26-19(2,3)4/h6,13-15H,1,7-12H2,2-5H3,(H,20,25)(H,22,23)/t13?,14-,15-/m0/s1 |
| InChIKey | JCJZZVBUBQRBCX-FGRDXJNISA-N |
| XLogP | 2.95 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|