About 3-(4-bromophenyl)-4H-1,4-benzoxazine
3-(4-bromophenyl)-4H-1,4-benzoxazine (PubChem CID 146597597) has the molecular formula C14H10BrNO
and a molecular weight of 288.14 g/mol. Its IUPAC name is 3-(4-bromophenyl)-4H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 3-(4-bromophenyl)-4H-1,4-benzoxazine |
| PubChem CID | 146597597 |
| Molecular Formula | C14H10BrNO |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | 3-(4-bromophenyl)-4H-1,4-benzoxazine |
| SMILES | Brc1ccc(C2=COc3ccccc3N2)cc1 |
| InChI | InChI=1S/C14H10BrNO/c15-11-7-5-10(6-8-11)13-9-17-14-4-2-1-3-12(14)16-13/h1-9,16H |
| InChIKey | ZYEDYCWLNGENGK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-bromophenyl)-4H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromophenyl)-4H-1,4-benzoxazine?
The IUPAC name of 3-(4-bromophenyl)-4H-1,4-benzoxazine (CID 146597597) is 3-(4-bromophenyl)-4H-1,4-benzoxazine.
What is the SMILES notation for 3-(4-bromophenyl)-4H-1,4-benzoxazine?
The canonical SMILES for 3-(4-bromophenyl)-4H-1,4-benzoxazine is Brc1ccc(C2=COc3ccccc3N2)cc1.
What is the InChIKey of 3-(4-bromophenyl)-4H-1,4-benzoxazine?
The InChIKey is ZYEDYCWLNGENGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrNO/c15-11-7-5-10(6-8-11)13-9-17-14-4-2-1-3-12(14)16-13/h1-9,16H.
What are the key properties of 3-(4-bromophenyl)-4H-1,4-benzoxazine?
3-(4-bromophenyl)-4H-1,4-benzoxazine has a molecular weight of 288.14 g/mol, XLogP of 4.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromophenyl)-4H-1,4-benzoxazine is sourced from PubChem (CID 146597597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).