C24H28F3NO6S — CID 146598214
tert-butyl 2-[(4-methylphenyl)sulfonyloxymethyl]-4-[(3,4,5-trifluorophenyl)methoxy]pyrrolidine-1-carboxylate (PubChem CID 146598214) has the molecular formula C24H28F3NO6S and a molecular weight of 515.55 g/mol. Its IUPAC name is tert-butyl 2-[(4-methylphenyl)sulfonyloxymethyl]-4-[(3,4,5-trifluorophenyl)methoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(4-methylphenyl)sulfonyloxymethyl]-4-[(3,4,5-trifluorophenyl)methoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 146598214 |
| Molecular Formula | C24H28F3NO6S |
| Molecular Weight | 515.55 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | tert-butyl 2-[(4-methylphenyl)sulfonyloxymethyl]-4-[(3,4,5-trifluorophenyl)methoxy]pyrrolidine-1-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CC(OCc3cc(F)c(F)c(F)c3)CN2C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H28F3NO6S/c1-15-5-7-19(8-6-15)35(30,31)33-14-17-11-18(12-28(17)23(29)34-24(2,3)4)32-13-16-9-20(25)22(27)21(26)10-16/h5-10,17-18H,11-14H2,1-4H3 |
| InChIKey | HXRUQVUGKLQJKE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|