C21H29FN4O5 — CID 146599529
3-[5-[3-[2-(3-amino-2-fluoropropoxy)ethoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 146599529) has the molecular formula C21H29FN4O5 and a molecular weight of 436.48 g/mol. Its IUPAC name is 3-[5-[3-[2-(3-amino-2-fluoropropoxy)ethoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[3-[2-(3-amino-2-fluoropropoxy)ethoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146599529 |
| Molecular Formula | C21H29FN4O5 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-[5-[3-[2-(3-amino-2-fluoropropoxy)ethoxy]propyl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2ccc(CCCOCCOCC(F)CN)cc21 |
| InChI | InChI=1S/C21H29FN4O5/c1-25-18-11-14(3-2-8-30-9-10-31-13-15(22)12-23)4-5-16(18)26(21(25)29)17-6-7-19(27)24-20(17)28/h4-5,11,15,17H,2-3,6-10,12-13,23H2,1H3,(H,24,27,28) |
| InChIKey | FLARWRPBZVBAHU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|