C33H34F2N8O6 — CID 146599791
3-[4-[1-[2-[[4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methoxy]ethyl]indazol-5-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione (PubChem CID 146599791) has the molecular formula C33H34F2N8O6 and a molecular weight of 676.68 g/mol. Its IUPAC name is 3-[4-[1-[2-[[4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methoxy]ethyl]indazol-5-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-[1-[2-[[4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methoxy]ethyl]indazol-5-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 146599791 |
| Molecular Formula | C33H34F2N8O6 |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | 3-[4-[1-[2-[[4-[3-(difluoromethyl)-4-nitropyrazol-1-yl]cyclohexyl]methoxy]ethyl]indazol-5-yl]-3-methyl-2-oxobenzimidazol-1-yl]piperidine-2,6-dione |
| SMILES | Cn1c(=O)n(C2CCC(=O)NC2=O)c2cccc(-c3ccc4c(cnn4CCOCC4CCC(n5cc([N+](=O)[O-])c(C(F)F)n5)CC4)c3)c21 |
| InChI | InChI=1S/C33H34F2N8O6/c1-39-30-23(3-2-4-25(30)42(33(39)46)26-11-12-28(44)37-32(26)45)20-7-10-24-21(15-20)16-36-40(24)13-14-49-18-19-5-8-22(9-6-19)41-17-27(43(47)48)29(38-41)31(34)35/h2-4,7,10,15-17,19,22,26,31H,5-6,8-9,11-14,18H2,1H3,(H,37,44,45) |
| InChIKey | BMTKRJCGZSBFGP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 161.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|