C17H28O2 — CID 146600611
4-(2,2,3,5,5-pentamethylhexan-3-yl)benzene-1,2-diol (PubChem CID 146600611) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 4-(2,2,3,5,5-pentamethylhexan-3-yl)benzene-1,2-diol.
| Compound Name | 4-(2,2,3,5,5-pentamethylhexan-3-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 146600611 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 4-(2,2,3,5,5-pentamethylhexan-3-yl)benzene-1,2-diol |
| SMILES | CC(C)(C)CC(C)(c1ccc(O)c(O)c1)C(C)(C)C |
| InChI | InChI=1S/C17H28O2/c1-15(2,3)11-17(7,16(4,5)6)12-8-9-13(18)14(19)10-12/h8-10,18-19H,11H2,1-7H3 |
| InChIKey | HTPZSJCAFYXXNY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|