About 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride
4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride (PubChem CID 146601362) has the molecular formula C14H10Cl2N2O3S
and a molecular weight of 357.22 g/mol. Its IUPAC name is 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride.
Molecular Properties
| Compound Name | 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride |
| PubChem CID | 146601362 |
| Molecular Formula | C14H10Cl2N2O3S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride |
| SMILES | CN(c1ccc(S(=O)(=O)Cl)cc1)c1nc2ccc(Cl)cc2o1 |
| InChI | InChI=1S/C14H10Cl2N2O3S/c1-18(10-3-5-11(6-4-10)22(16,19)20)14-17-12-7-2-9(15)8-13(12)21-14/h2-8H,1H3 |
| InChIKey | YPMYRTSLPSMSHJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride?
The IUPAC name of 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride (CID 146601362) is 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride.
What is the SMILES notation for 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride?
The canonical SMILES for 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride is CN(c1ccc(S(=O)(=O)Cl)cc1)c1nc2ccc(Cl)cc2o1.
What is the InChIKey of 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride?
The InChIKey is YPMYRTSLPSMSHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N2O3S/c1-18(10-3-5-11(6-4-10)22(16,19)20)14-17-12-7-2-9(15)8-13(12)21-14/h2-8H,1H3.
What are the key properties of 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride?
4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride has a molecular weight of 357.22 g/mol, XLogP of 4.18, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(6-chloro-1,3-benzoxazol-2-yl)-methylamino]benzenesulfonyl chloride is sourced from PubChem (CID 146601362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).