C19H39NO — CID 146601894
2-[[(Z)-2,4,4,7,7,9,9-heptamethyldec-5-en-2-yl]amino]ethanol (PubChem CID 146601894) has the molecular formula C19H39NO and a molecular weight of 297.53 g/mol. Its IUPAC name is 2-[[(Z)-2,4,4,7,7,9,9-heptamethyldec-5-en-2-yl]amino]ethanol.
| Compound Name | 2-[[(Z)-2,4,4,7,7,9,9-heptamethyldec-5-en-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 146601894 |
| Molecular Formula | C19H39NO |
| Molecular Weight | 297.53 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | 2-[[(Z)-2,4,4,7,7,9,9-heptamethyldec-5-en-2-yl]amino]ethanol |
| SMILES | CC(C)(C)CC(C)(C)/C=C\C(C)(C)CC(C)(C)NCCO |
| InChI | InChI=1S/C19H39NO/c1-16(2,3)14-17(4,5)10-11-18(6,7)15-19(8,9)20-12-13-21/h10-11,20-21H,12-15H2,1-9H3/b11-10- |
| InChIKey | LBGZKMXWFYBFDE-KHPPLWFESA-N |
| XLogP | 4.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|