About 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile
1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile (PubChem CID 146602192) has the molecular formula C13H25N2O2P
and a molecular weight of 272.33 g/mol. Its IUPAC name is 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile.
Molecular Properties
| Compound Name | 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile |
| PubChem CID | 146602192 |
| Molecular Formula | C13H25N2O2P |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile |
| SMILES | CCP(=O)(OCC(C)(C)C)N1CCC(C#N)CC1 |
| InChI | InChI=1S/C13H25N2O2P/c1-5-18(16,17-11-13(2,3)4)15-8-6-12(10-14)7-9-15/h12H,5-9,11H2,1-4H3 |
| InChIKey | XMZTVWSNFDZOMK-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile?
The IUPAC name of 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile (CID 146602192) is 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile.
What is the SMILES notation for 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile?
The canonical SMILES for 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile is CCP(=O)(OCC(C)(C)C)N1CCC(C#N)CC1.
What is the InChIKey of 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile?
The InChIKey is XMZTVWSNFDZOMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N2O2P/c1-5-18(16,17-11-13(2,3)4)15-8-6-12(10-14)7-9-15/h12H,5-9,11H2,1-4H3.
What are the key properties of 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile?
1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile has a molecular weight of 272.33 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-dimethylpropoxy(ethyl)phosphoryl]piperidine-4-carbonitrile is sourced from PubChem (CID 146602192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).