C17H33N — CID 146602932
4,5-ditert-butyl-1,2,3,6-tetramethyl-3,6-dihydro-2H-pyridine (PubChem CID 146602932) has the molecular formula C17H33N and a molecular weight of 251.46 g/mol. Its IUPAC name is 4,5-ditert-butyl-1,2,3,6-tetramethyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4,5-ditert-butyl-1,2,3,6-tetramethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 146602932 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | 4,5-ditert-butyl-1,2,3,6-tetramethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1C(C(C)(C)C)=C(C(C)(C)C)C(C)N(C)C1C |
| InChI | InChI=1S/C17H33N/c1-11-12(2)18(10)13(3)15(17(7,8)9)14(11)16(4,5)6/h11-13H,1-10H3 |
| InChIKey | WRUFGUKUJNLASO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|