C30H31N3O — CID 146603319
2-[2-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethyl]chromen-4-ylidene]propanedinitrile (PubChem CID 146603319) has the molecular formula C30H31N3O and a molecular weight of 449.60 g/mol. Its IUPAC name is 2-[2-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethyl]chromen-4-ylidene]propanedinitrile.
| Compound Name | 2-[2-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethyl]chromen-4-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 146603319 |
| Molecular Formula | C30H31N3O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 2-[2-[2-(4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethyl]chromen-4-ylidene]propanedinitrile |
| SMILES | CC1(C)CCN2CCC(C)(C)c3cc(CCC4=CC(=C(C#N)C#N)c5ccccc5O4)cc1c32 |
| InChI | InChI=1S/C30H31N3O/c1-29(2)11-13-33-14-12-30(3,4)26-16-20(15-25(29)28(26)33)9-10-22-17-24(21(18-31)19-32)23-7-5-6-8-27(23)34-22/h5-8,15-17H,9-14H2,1-4H3 |
| InChIKey | YMHOHQMOLHHQPZ-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 60.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|