C22H28N6O — CID 14660350
2-[3-(1H-imidazol-5-yl)propyl]-1-[3-(4-methoxyphenyl)-3-pyridin-2-ylpropyl]guanidine (PubChem CID 14660350) has the molecular formula C22H28N6O and a molecular weight of 392.51 g/mol. Its IUPAC name is 2-[3-(1H-imidazol-5-yl)propyl]-1-[3-(4-methoxyphenyl)-3-pyridin-2-ylpropyl]guanidine.
| Compound Name | 2-[3-(1H-imidazol-5-yl)propyl]-1-[3-(4-methoxyphenyl)-3-pyridin-2-ylpropyl]guanidine |
|---|---|
| PubChem CID | 14660350 |
| Molecular Formula | C22H28N6O |
| Molecular Weight | 392.51 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[3-(1H-imidazol-5-yl)propyl]-1-[3-(4-methoxyphenyl)-3-pyridin-2-ylpropyl]guanidine |
| SMILES | COc1ccc(C(CCN/C(N)=N/CCCc2cnc[nH]2)c2ccccn2)cc1 |
| InChI | InChI=1S/C22H28N6O/c1-29-19-9-7-17(8-10-19)20(21-6-2-3-12-25-21)11-14-27-22(23)26-13-4-5-18-15-24-16-28-18/h2-3,6-10,12,15-16,20H,4-5,11,13-14H2,1H3,(H,24,28)(H3,23,26,27) |
| InChIKey | NJSDMTVYWHLODK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.51 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|