About 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one
5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one (PubChem CID 146603620) has the molecular formula C20H20F2N2O2
and a molecular weight of 358.39 g/mol. Its IUPAC name is 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one.
Molecular Properties
| Compound Name | 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one |
| PubChem CID | 146603620 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one |
| SMILES | COc1ccc(C2(c3cc(C)c(F)cc3F)N=C(C)N(C)C2=O)cc1C |
| InChI | InChI=1S/C20H20F2N2O2/c1-11-9-15(17(22)10-16(11)21)20(19(25)24(4)13(3)23-20)14-6-7-18(26-5)12(2)8-14/h6-10H,1-5H3 |
| InChIKey | YWOFFXNGGQWHJO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one?
The IUPAC name of 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one (CID 146603620) is 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one.
What is the SMILES notation for 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one?
The canonical SMILES for 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one is COc1ccc(C2(c3cc(C)c(F)cc3F)N=C(C)N(C)C2=O)cc1C.
What is the InChIKey of 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one?
The InChIKey is YWOFFXNGGQWHJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20F2N2O2/c1-11-9-15(17(22)10-16(11)21)20(19(25)24(4)13(3)23-20)14-6-7-18(26-5)12(2)8-14/h6-10H,1-5H3.
What are the key properties of 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one?
5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one has a molecular weight of 358.39 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-difluoro-5-methylphenyl)-5-(4-methoxy-3-methylphenyl)-2,3-dimethylimidazol-4-one is sourced from PubChem (CID 146603620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).