C19H24N6S — CID 14660411
2-[3-(1H-imidazol-5-yl)propyl]-1-(3-pyridin-2-yl-3-thiophen-2-ylpropyl)guanidine (PubChem CID 14660411) has the molecular formula C19H24N6S and a molecular weight of 368.51 g/mol. Its IUPAC name is 2-[3-(1H-imidazol-5-yl)propyl]-1-(3-pyridin-2-yl-3-thiophen-2-ylpropyl)guanidine.
| Compound Name | 2-[3-(1H-imidazol-5-yl)propyl]-1-(3-pyridin-2-yl-3-thiophen-2-ylpropyl)guanidine |
|---|---|
| PubChem CID | 14660411 |
| Molecular Formula | C19H24N6S |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[3-(1H-imidazol-5-yl)propyl]-1-(3-pyridin-2-yl-3-thiophen-2-ylpropyl)guanidine |
| SMILES | N/C(=N\CCCc1cnc[nH]1)NCCC(c1ccccn1)c1cccs1 |
| InChI | InChI=1S/C19H24N6S/c20-19(23-10-3-5-15-13-21-14-25-15)24-11-8-16(18-7-4-12-26-18)17-6-1-2-9-22-17/h1-2,4,6-7,9,12-14,16H,3,5,8,10-11H2,(H,21,25)(H3,20,23,24) |
| InChIKey | IBNXHHGKQLJEJQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|