About 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole
4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole (PubChem CID 146604419) has the molecular formula C4F6IN3
and a molecular weight of 330.96 g/mol. Its IUPAC name is 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole.
Molecular Properties
| Compound Name | 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole |
| PubChem CID | 146604419 |
| Molecular Formula | C4F6IN3 |
| Molecular Weight | 330.96 g/mol |
| Exact Mass | 330.90 |
| IUPAC Name | 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole |
| SMILES | FC(F)(F)c1nnc(C(F)(F)F)n1I |
| InChI | InChI=1S/C4F6IN3/c5-3(6,7)1-12-13-2(14(1)11)4(8,9)10 |
| InChIKey | UZCACUWSQCOJMT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.96 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole?
The IUPAC name of 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole (CID 146604419) is 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole.
What is the SMILES notation for 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole?
The canonical SMILES for 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole is FC(F)(F)c1nnc(C(F)(F)F)n1I.
What is the InChIKey of 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole?
The InChIKey is UZCACUWSQCOJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4F6IN3/c5-3(6,7)1-12-13-2(14(1)11)4(8,9)10.
What are the key properties of 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole?
4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole has a molecular weight of 330.96 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-3,5-bis(trifluoromethyl)-1,2,4-triazole is sourced from PubChem (CID 146604419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).