About 2-propylideneadamantane
2-propylideneadamantane (PubChem CID 14660456) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is 2-propylideneadamantane.
Molecular Properties
| Compound Name | 2-propylideneadamantane |
| PubChem CID | 14660456 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | 2-propylideneadamantane |
| SMILES | CCC=C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C13H20/c1-2-3-13-11-5-9-4-10(7-11)8-12(13)6-9/h3,9-12H,2,4-8H2,1H3/b13-3- |
| InChIKey | NMSHDLHOYYNLED-DXNYSGJVSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-propylideneadamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylideneadamantane?
The IUPAC name of 2-propylideneadamantane (CID 14660456) is 2-propylideneadamantane.
What is the SMILES notation for 2-propylideneadamantane?
The canonical SMILES for 2-propylideneadamantane is CCC=C1C2CC3CC(C2)CC1C3.
What is the InChIKey of 2-propylideneadamantane?
The InChIKey is NMSHDLHOYYNLED-DXNYSGJVSA-N. The full InChI is InChI=1S/C13H20/c1-2-3-13-11-5-9-4-10(7-11)8-12(13)6-9/h3,9-12H,2,4-8H2,1H3/b13-3-.
What are the key properties of 2-propylideneadamantane?
2-propylideneadamantane has a molecular weight of 176.30 g/mol, XLogP of 3.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylideneadamantane is sourced from PubChem (CID 14660456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).