About 2-(2,4-dimethylpentan-3-ylidene)adamantane
2-(2,4-dimethylpentan-3-ylidene)adamantane (PubChem CID 14660461) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is 2-(2,4-dimethylpentan-3-ylidene)adamantane.
Molecular Properties
| Compound Name | 2-(2,4-dimethylpentan-3-ylidene)adamantane |
| PubChem CID | 14660461 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 2-(2,4-dimethylpentan-3-ylidene)adamantane |
| SMILES | CC(C)C(=C1C2CC3CC(C2)CC1C3)C(C)C |
| InChI | InChI=1S/C17H28/c1-10(2)16(11(3)4)17-14-6-12-5-13(8-14)9-15(17)7-12/h10-15H,5-9H2,1-4H3 |
| InChIKey | NTNOMYSADMASLB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dimethylpentan-3-ylidene)adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dimethylpentan-3-ylidene)adamantane?
The IUPAC name of 2-(2,4-dimethylpentan-3-ylidene)adamantane (CID 14660461) is 2-(2,4-dimethylpentan-3-ylidene)adamantane.
What is the SMILES notation for 2-(2,4-dimethylpentan-3-ylidene)adamantane?
The canonical SMILES for 2-(2,4-dimethylpentan-3-ylidene)adamantane is CC(C)C(=C1C2CC3CC(C2)CC1C3)C(C)C.
What is the InChIKey of 2-(2,4-dimethylpentan-3-ylidene)adamantane?
The InChIKey is NTNOMYSADMASLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-10(2)16(11(3)4)17-14-6-12-5-13(8-14)9-15(17)7-12/h10-15H,5-9H2,1-4H3.
What are the key properties of 2-(2,4-dimethylpentan-3-ylidene)adamantane?
2-(2,4-dimethylpentan-3-ylidene)adamantane has a molecular weight of 232.41 g/mol, XLogP of 5.05, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dimethylpentan-3-ylidene)adamantane is sourced from PubChem (CID 14660461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).