C17H20N2 — CID 146604711
(2E,4Z)-3-(1-methyl-4,9-dimethylideneazonin-2-yl)hexa-2,4-dien-1-imine (PubChem CID 146604711) has the molecular formula C17H20N2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (2E,4Z)-3-(1-methyl-4,9-dimethylideneazonin-2-yl)hexa-2,4-dien-1-imine.
| Compound Name | (2E,4Z)-3-(1-methyl-4,9-dimethylideneazonin-2-yl)hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 146604711 |
| Molecular Formula | C17H20N2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | (2E,4Z)-3-(1-methyl-4,9-dimethylideneazonin-2-yl)hexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C(\C=C/C)c1cc(=C)ccccc(=C)n1C |
| InChI | InChI=1S/C17H20N2/c1-5-8-16(11-12-18)17-13-14(2)9-6-7-10-15(3)19(17)4/h5-13,18H,2-3H2,1,4H3/b8-5-,9-6-,10-7-,16-11+,17-13-,18-12+ |
| InChIKey | NGLPALRIVMWEFC-JPVRWNHLSA-N |
| XLogP | 2.58 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|