C19H20F3N7OS — CID 146605247
N-[5-[[(3S)-3-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-5-(trifluoromethyl)-2,3,4,7-tetrahydroazepin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 146605247) has the molecular formula C19H20F3N7OS and a molecular weight of 451.48 g/mol. Its IUPAC name is N-[5-[[(3S)-3-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-5-(trifluoromethyl)-2,3,4,7-tetrahydroazepin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-[[(3S)-3-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-5-(trifluoromethyl)-2,3,4,7-tetrahydroazepin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 146605247 |
| Molecular Formula | C19H20F3N7OS |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-[5-[[(3S)-3-(5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-5-(trifluoromethyl)-2,3,4,7-tetrahydroazepin-1-yl]methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1ncc(CN2CC=C(C(F)(F)F)C[C@H](c3cc(C)nc4ncnn34)C2)s1 |
| InChI | InChI=1S/C19H20F3N7OS/c1-11-5-16(29-17(26-11)24-10-25-29)13-6-14(19(20,21)22)3-4-28(8-13)9-15-7-23-18(31-15)27-12(2)30/h3,5,7,10,13H,4,6,8-9H2,1-2H3,(H,23,27,30)/t13-/m0/s1 |
| InChIKey | NUQWIPAHOCEUQX-ZDUSSCGKSA-N |
| XLogP | 3.33 |
| TPSA | 88.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|