C8H8F5NO6S — CID 146605607
1,1,3,3,3-pentafluoro-2-(5-oxopyrrolidine-2-carbonyl)oxypropane-1-sulfonic acid (PubChem CID 146605607) has the molecular formula C8H8F5NO6S and a molecular weight of 341.21 g/mol. Its IUPAC name is 1,1,3,3,3-pentafluoro-2-(5-oxopyrrolidine-2-carbonyl)oxypropane-1-sulfonic acid.
| Compound Name | 1,1,3,3,3-pentafluoro-2-(5-oxopyrrolidine-2-carbonyl)oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 146605607 |
| Molecular Formula | C8H8F5NO6S |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | 1,1,3,3,3-pentafluoro-2-(5-oxopyrrolidine-2-carbonyl)oxypropane-1-sulfonic acid |
| SMILES | O=C1CCC(C(=O)OC(C(F)(F)F)C(F)(F)S(=O)(=O)O)N1 |
| InChI | InChI=1S/C8H8F5NO6S/c9-7(10,11)6(8(12,13)21(17,18)19)20-5(16)3-1-2-4(15)14-3/h3,6H,1-2H2,(H,14,15)(H,17,18,19) |
| InChIKey | HEPRBNAJGDHKHA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|