About 2,3,5-trimethylselenophene
2,3,5-trimethylselenophene (PubChem CID 14660589) has the molecular formula C7H10Se
and a molecular weight of 173.12 g/mol. Its IUPAC name is 2,3,5-trimethylselenophene.
Molecular Properties
| Compound Name | 2,3,5-trimethylselenophene |
| PubChem CID | 14660589 |
| Molecular Formula | C7H10Se |
| Molecular Weight | 173.12 g/mol |
| Exact Mass | 173.99 |
| IUPAC Name | 2,3,5-trimethylselenophene |
| SMILES | Cc1cc(C)c(C)[se]1 |
| InChI | InChI=1S/C7H10Se/c1-5-4-6(2)8-7(5)3/h4H,1-3H3 |
| InChIKey | XHTPGMULOYWSIK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.12 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3,5-trimethylselenophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,5-trimethylselenophene?
The IUPAC name of 2,3,5-trimethylselenophene (CID 14660589) is 2,3,5-trimethylselenophene.
What is the SMILES notation for 2,3,5-trimethylselenophene?
The canonical SMILES for 2,3,5-trimethylselenophene is Cc1cc(C)c(C)[se]1.
What is the InChIKey of 2,3,5-trimethylselenophene?
The InChIKey is XHTPGMULOYWSIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10Se/c1-5-4-6(2)8-7(5)3/h4H,1-3H3.
What are the key properties of 2,3,5-trimethylselenophene?
2,3,5-trimethylselenophene has a molecular weight of 173.12 g/mol, XLogP of 1.67, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,5-trimethylselenophene is sourced from PubChem (CID 14660589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).