C23H24F6N4O7S — CID 146606805
2-methylsulfonyl-N-[(4R)-4'-oxo-7-(2,2,2-trifluoroethoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[2,3-dihydrochromene-4,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide (PubChem CID 146606805) has the molecular formula C23H24F6N4O7S and a molecular weight of 614.52 g/mol. Its IUPAC name is 2-methylsulfonyl-N-[(4R)-4'-oxo-7-(2,2,2-trifluoroethoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[2,3-dihydrochromene-4,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide.
| Compound Name | 2-methylsulfonyl-N-[(4R)-4'-oxo-7-(2,2,2-trifluoroethoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[2,3-dihydrochromene-4,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide |
|---|---|
| PubChem CID | 146606805 |
| Molecular Formula | C23H24F6N4O7S |
| Molecular Weight | 614.52 g/mol |
| Exact Mass | 614.13 |
| IUPAC Name | 2-methylsulfonyl-N-[(4R)-4'-oxo-7-(2,2,2-trifluoroethoxy)-2'-[3-(trifluoromethoxy)propyl]spiro[2,3-dihydrochromene-4,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-yl]acetamide |
| SMILES | CS(=O)(=O)CC(=O)Nc1c2c(nn1CCCOC(F)(F)F)C[C@]1(CCOc3cc(OCC(F)(F)F)ccc31)NC2=O |
| InChI | InChI=1S/C23H24F6N4O7S/c1-41(36,37)11-17(34)30-19-18-15(32-33(19)6-2-7-40-23(27,28)29)10-21(31-20(18)35)5-8-38-16-9-13(3-4-14(16)21)39-12-22(24,25)26/h3-4,9H,2,5-8,10-12H2,1H3,(H,30,34)(H,31,35)/t21-/m0/s1 |
| InChIKey | JATLANXSNSDNJP-NRFANRHFSA-N |
| XLogP | 2.70 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|