C27H26F3N3O5S — CID 146606919
N-[(3S)-1'-methyl-4'-oxo-2'-phenyl-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrrolo[3,2-c]pyridine]-3'-yl]-2-methylsulfonylacetamide (PubChem CID 146606919) has the molecular formula C27H26F3N3O5S and a molecular weight of 561.58 g/mol. Its IUPAC name is N-[(3S)-1'-methyl-4'-oxo-2'-phenyl-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrrolo[3,2-c]pyridine]-3'-yl]-2-methylsulfonylacetamide.
| Compound Name | N-[(3S)-1'-methyl-4'-oxo-2'-phenyl-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrrolo[3,2-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 146606919 |
| Molecular Formula | C27H26F3N3O5S |
| Molecular Weight | 561.58 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | N-[(3S)-1'-methyl-4'-oxo-2'-phenyl-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrrolo[3,2-c]pyridine]-3'-yl]-2-methylsulfonylacetamide |
| SMILES | Cn1c2c(c(NC(=O)CS(C)(=O)=O)c1-c1ccccc1)C(=O)N[C@@]1(CCc3cc(OCC(F)(F)F)ccc31)C2 |
| InChI | InChI=1S/C27H26F3N3O5S/c1-33-20-13-26(11-10-17-12-18(8-9-19(17)26)38-15-27(28,29)30)32-25(35)22(20)23(31-21(34)14-39(2,36)37)24(33)16-6-4-3-5-7-16/h3-9,12H,10-11,13-15H2,1-2H3,(H,31,34)(H,32,35)/t26-/m0/s1 |
| InChIKey | AJHFLMZQGJERAJ-SANMLTNESA-N |
| XLogP | 3.74 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.58 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |