C25H22N2O2 — CID 146606993
1-[(4S)-6-(4-ethynylphenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]-3-methylbutan-2-one (PubChem CID 146606993) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 1-[(4S)-6-(4-ethynylphenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]-3-methylbutan-2-one.
| Compound Name | 1-[(4S)-6-(4-ethynylphenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 146606993 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[(4S)-6-(4-ethynylphenyl)-1-methyl-4H-[1,2]oxazolo[5,4-d][2]benzazepin-4-yl]-3-methylbutan-2-one |
| SMILES | C#Cc1ccc(C2=N[C@@H](CC(=O)C(C)C)c3onc(C)c3-c3ccccc32)cc1 |
| InChI | InChI=1S/C25H22N2O2/c1-5-17-10-12-18(13-11-17)24-20-9-7-6-8-19(20)23-16(4)27-29-25(23)21(26-24)14-22(28)15(2)3/h1,6-13,15,21H,14H2,2-4H3/t21-/m0/s1 |
| InChIKey | QUYANVCDDNGUBD-NRFANRHFSA-N |
| XLogP | 5.14 |
| TPSA | 55.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|