C7H9F7O — CID 146607260
2,2,3,3,4,4,5-heptafluoro-5-methoxyhexane (PubChem CID 146607260) has the molecular formula C7H9F7O and a molecular weight of 242.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,5-heptafluoro-5-methoxyhexane.
| Compound Name | 2,2,3,3,4,4,5-heptafluoro-5-methoxyhexane |
|---|---|
| PubChem CID | 146607260 |
| Molecular Formula | C7H9F7O |
| Molecular Weight | 242.13 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2,2,3,3,4,4,5-heptafluoro-5-methoxyhexane |
| SMILES | COC(C)(F)C(F)(F)C(F)(F)C(C)(F)F |
| InChI | InChI=1S/C7H9F7O/c1-4(8,9)6(11,12)7(13,14)5(2,10)15-3/h1-3H3 |
| InChIKey | DOPHMPXNTILEEL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.13 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|