C23H26F5N5O6S — CID 146608257
(3S)-2'-[3-(difluoromethoxy)propyl]-4'-oxo-N-(2-sulfamoylethyl)-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-carboxamide (PubChem CID 146608257) has the molecular formula C23H26F5N5O6S and a molecular weight of 595.55 g/mol. Its IUPAC name is (3S)-2'-[3-(difluoromethoxy)propyl]-4'-oxo-N-(2-sulfamoylethyl)-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-carboxamide.
| Compound Name | (3S)-2'-[3-(difluoromethoxy)propyl]-4'-oxo-N-(2-sulfamoylethyl)-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-carboxamide |
|---|---|
| PubChem CID | 146608257 |
| Molecular Formula | C23H26F5N5O6S |
| Molecular Weight | 595.55 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | (3S)-2'-[3-(difluoromethoxy)propyl]-4'-oxo-N-(2-sulfamoylethyl)-6-(2,2,2-trifluoroethoxy)spiro[1,2-dihydroindene-3,6'-5,7-dihydropyrazolo[4,3-c]pyridine]-3'-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1c2c(nn1CCCOC(F)F)C[C@]1(CCc3cc(OCC(F)(F)F)ccc31)NC2=O |
| InChI | InChI=1S/C23H26F5N5O6S/c24-21(25)38-8-1-7-33-18(20(35)30-6-9-40(29,36)37)17-16(32-33)11-22(31-19(17)34)5-4-13-10-14(2-3-15(13)22)39-12-23(26,27)28/h2-3,10,21H,1,4-9,11-12H2,(H,30,35)(H,31,34)(H2,29,36,37)/t22-/m0/s1 |
| InChIKey | FKANKPJNTCEXJN-QFIPXVFZSA-N |
| XLogP | 1.60 |
| TPSA | 154.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.55 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|