C20H25N — CID 146608402
N-[(2E,4Z,7Z)-5-methyl-3-(2-methylcyclohepta-1,4,6-trien-1-yl)-6-methylidenenona-2,4,7-trien-4-yl]methanimine (PubChem CID 146608402) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is N-[(2E,4Z,7Z)-5-methyl-3-(2-methylcyclohepta-1,4,6-trien-1-yl)-6-methylidenenona-2,4,7-trien-4-yl]methanimine.
| Compound Name | N-[(2E,4Z,7Z)-5-methyl-3-(2-methylcyclohepta-1,4,6-trien-1-yl)-6-methylidenenona-2,4,7-trien-4-yl]methanimine |
|---|---|
| PubChem CID | 146608402 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | N-[(2E,4Z,7Z)-5-methyl-3-(2-methylcyclohepta-1,4,6-trien-1-yl)-6-methylidenenona-2,4,7-trien-4-yl]methanimine |
| SMILES | C=NC(=C(/C)C(=C)/C=C\C)/C(=C/C)C1=C(C)CC=CC=C1 |
| InChI | InChI=1S/C20H25N/c1-7-12-15(3)17(5)20(21-6)18(8-2)19-14-11-9-10-13-16(19)4/h7-12,14H,3,6,13H2,1-2,4-5H3/b12-7-,18-8+,20-17- |
| InChIKey | FFWDLYYMZCNKLS-AUJWUJLWSA-N |
| XLogP | 5.87 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|