C24H26F3N4OPS — CID 146608746
N-(3,4-difluoro-5-phosphanylphenyl)-3-[3-(4-fluorophenyl)propyl]-1-imino-7-methyl-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide (PubChem CID 146608746) has the molecular formula C24H26F3N4OPS and a molecular weight of 506.53 g/mol. Its IUPAC name is N-(3,4-difluoro-5-phosphanylphenyl)-3-[3-(4-fluorophenyl)propyl]-1-imino-7-methyl-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide.
| Compound Name | N-(3,4-difluoro-5-phosphanylphenyl)-3-[3-(4-fluorophenyl)propyl]-1-imino-7-methyl-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
|---|---|
| PubChem CID | 146608746 |
| Molecular Formula | C24H26F3N4OPS |
| Molecular Weight | 506.53 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | N-(3,4-difluoro-5-phosphanylphenyl)-3-[3-(4-fluorophenyl)propyl]-1-imino-7-methyl-2,3,4,5-tetrahydropyrrolo[3,4-f]thiazepine-6-carboxamide |
| SMILES | [H]/N=S1\NC(CCCc2ccc(F)cc2)CCc2c1cn(C)c2C(=O)Nc1cc(F)c(F)c(P)c1 |
| InChI | InChI=1S/C24H26F3N4OPS/c1-31-13-21-18(23(31)24(32)29-17-11-19(26)22(27)20(33)12-17)10-9-16(30-34(21)28)4-2-3-14-5-7-15(25)8-6-14/h5-8,11-13,16H,2-4,9-10,33H2,1H3,(H2,28,30)(H,29,32) |
| InChIKey | KCWAXXNOAUTJSI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|