C23H24F2O3 — CID 146608759
[(1R,2S)-7-[(2,4-difluorophenyl)methoxy]-5,8-dimethyl-2-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl] formate (PubChem CID 146608759) has the molecular formula C23H24F2O3 and a molecular weight of 386.44 g/mol. Its IUPAC name is [(1R,2S)-7-[(2,4-difluorophenyl)methoxy]-5,8-dimethyl-2-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl] formate.
| Compound Name | [(1R,2S)-7-[(2,4-difluorophenyl)methoxy]-5,8-dimethyl-2-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl] formate |
|---|---|
| PubChem CID | 146608759 |
| Molecular Formula | C23H24F2O3 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | [(1R,2S)-7-[(2,4-difluorophenyl)methoxy]-5,8-dimethyl-2-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalen-1-yl] formate |
| SMILES | C=C(C)[C@@H]1CCc2c(C)cc(OCc3ccc(F)cc3F)c(C)c2[C@@H]1OC=O |
| InChI | InChI=1S/C23H24F2O3/c1-13(2)18-7-8-19-14(3)9-21(15(4)22(19)23(18)28-12-26)27-11-16-5-6-17(24)10-20(16)25/h5-6,9-10,12,18,23H,1,7-8,11H2,2-4H3/t18-,23+/m0/s1 |
| InChIKey | WQENVRRNTFQPGC-FDDCHVKYSA-N |
| XLogP | 5.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|