C23H26Cl2O2 — CID 146608786
(1R,2S)-7-[(2,6-dichlorophenyl)methoxy]-1-methoxy-5,8-dimethyl-2-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene (PubChem CID 146608786) has the molecular formula C23H26Cl2O2 and a molecular weight of 405.37 g/mol. Its IUPAC name is (1R,2S)-7-[(2,6-dichlorophenyl)methoxy]-1-methoxy-5,8-dimethyl-2-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | (1R,2S)-7-[(2,6-dichlorophenyl)methoxy]-1-methoxy-5,8-dimethyl-2-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 146608786 |
| Molecular Formula | C23H26Cl2O2 |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | (1R,2S)-7-[(2,6-dichlorophenyl)methoxy]-1-methoxy-5,8-dimethyl-2-prop-1-en-2-yl-1,2,3,4-tetrahydronaphthalene |
| SMILES | C=C(C)[C@@H]1CCc2c(C)cc(OCc3c(Cl)cccc3Cl)c(C)c2[C@@H]1OC |
| InChI | InChI=1S/C23H26Cl2O2/c1-13(2)16-9-10-17-14(3)11-21(15(4)22(17)23(16)26-5)27-12-18-19(24)7-6-8-20(18)25/h6-8,11,16,23H,1,9-10,12H2,2-5H3/t16-,23+/m0/s1 |
| InChIKey | FDUTYTSKJHJKPH-QMHKHESXSA-N |
| XLogP | 7.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|