C31H38FNO5 — CID 146608854
ethyl (2R)-1-[3-[(9bR)-8-[(2-fluorophenyl)methoxy]-6,9-dimethyl-2-oxo-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-3-yl]propyl]pyrrolidine-2-carboxylate (PubChem CID 146608854) has the molecular formula C31H38FNO5 and a molecular weight of 523.65 g/mol. Its IUPAC name is ethyl (2R)-1-[3-[(9bR)-8-[(2-fluorophenyl)methoxy]-6,9-dimethyl-2-oxo-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-3-yl]propyl]pyrrolidine-2-carboxylate.
| Compound Name | ethyl (2R)-1-[3-[(9bR)-8-[(2-fluorophenyl)methoxy]-6,9-dimethyl-2-oxo-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-3-yl]propyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 146608854 |
| Molecular Formula | C31H38FNO5 |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | ethyl (2R)-1-[3-[(9bR)-8-[(2-fluorophenyl)methoxy]-6,9-dimethyl-2-oxo-3a,4,5,9b-tetrahydro-3H-benzo[g][1]benzofuran-3-yl]propyl]pyrrolidine-2-carboxylate |
| SMILES | CCOC(=O)[C@H]1CCCN1CCCC1C(=O)O[C@H]2c3c(C)c(OCc4ccccc4F)cc(C)c3CCC12 |
| InChI | InChI=1S/C31H38FNO5/c1-4-36-31(35)26-12-8-16-33(26)15-7-10-24-23-14-13-22-19(2)17-27(20(3)28(22)29(23)38-30(24)34)37-18-21-9-5-6-11-25(21)32/h5-6,9,11,17,23-24,26,29H,4,7-8,10,12-16,18H2,1-3H3/t23?,24?,26-,29-/m1/s1 |
| InChIKey | KRYQMTMJTLVLLY-BPQLHUBLSA-N |
| XLogP | 5.61 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |