C44H31N3 — CID 146609289
2,4-bis(3-phenylphenyl)-6-[3-(5-tetracyclo[6.3.0.01,4.07,9]undeca-2,5,10-trienyl)phenyl]-1,3,5-triazine (PubChem CID 146609289) has the molecular formula C44H31N3 and a molecular weight of 601.75 g/mol. Its IUPAC name is 2,4-bis(3-phenylphenyl)-6-[3-(5-tetracyclo[6.3.0.01,4.07,9]undeca-2,5,10-trienyl)phenyl]-1,3,5-triazine.
| Compound Name | 2,4-bis(3-phenylphenyl)-6-[3-(5-tetracyclo[6.3.0.01,4.07,9]undeca-2,5,10-trienyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 146609289 |
| Molecular Formula | C44H31N3 |
| Molecular Weight | 601.75 g/mol |
| Exact Mass | 601.25 |
| IUPAC Name | 2,4-bis(3-phenylphenyl)-6-[3-(5-tetracyclo[6.3.0.01,4.07,9]undeca-2,5,10-trienyl)phenyl]-1,3,5-triazine |
| SMILES | C1=CC23C=CC2C(c2cccc(-c4nc(-c5cccc(-c6ccccc6)c5)nc(-c5cccc(-c6ccccc6)c5)n4)c2)=CC2C1C23 |
| InChI | InChI=1S/C44H31N3/c1-3-10-28(11-4-1)30-14-7-17-33(24-30)41-45-42(34-18-8-15-31(25-34)29-12-5-2-6-13-29)47-43(46-41)35-19-9-16-32(26-35)37-27-38-36-20-22-44(40(36)38)23-21-39(37)44/h1-27,36,38-40H |
| InChIKey | FLOLEMSGSQGHCF-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.75 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|