C27H28N6O2 — CID 146609471
(E)-4-[4-[2-methoxy-7-(8-methylnaphthalen-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-4-oxobut-2-enenitrile (PubChem CID 146609471) has the molecular formula C27H28N6O2 and a molecular weight of 468.56 g/mol. Its IUPAC name is (E)-4-[4-[2-methoxy-7-(8-methylnaphthalen-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-4-oxobut-2-enenitrile.
| Compound Name | (E)-4-[4-[2-methoxy-7-(8-methylnaphthalen-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-4-oxobut-2-enenitrile |
|---|---|
| PubChem CID | 146609471 |
| Molecular Formula | C27H28N6O2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (E)-4-[4-[2-methoxy-7-(8-methylnaphthalen-1-yl)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-4-oxobut-2-enenitrile |
| SMILES | COc1nc2c(c(N3CCN(C(=O)/C=C/C#N)CC3)n1)CCN(c1cccc3cccc(C)c13)C2 |
| InChI | InChI=1S/C27H28N6O2/c1-19-6-3-7-20-8-4-9-23(25(19)20)33-13-11-21-22(18-33)29-27(35-2)30-26(21)32-16-14-31(15-17-32)24(34)10-5-12-28/h3-10H,11,13-18H2,1-2H3/b10-5+ |
| InChIKey | ZZWAARBFLMCZHP-BJMVGYQFSA-N |
| XLogP | 3.24 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|