C29H25N5O5 — CID 146609600
[[7-(4-cyanophenoxy)-2-methyl-1-benzofuran-3-yl]methylamino]methyl (E)-3-(4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl)prop-2-enoate (PubChem CID 146609600) has the molecular formula C29H25N5O5 and a molecular weight of 523.55 g/mol. Its IUPAC name is [[7-(4-cyanophenoxy)-2-methyl-1-benzofuran-3-yl]methylamino]methyl (E)-3-(4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl)prop-2-enoate.
| Compound Name | [[7-(4-cyanophenoxy)-2-methyl-1-benzofuran-3-yl]methylamino]methyl (E)-3-(4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl)prop-2-enoate |
|---|---|
| PubChem CID | 146609600 |
| Molecular Formula | C29H25N5O5 |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | [[7-(4-cyanophenoxy)-2-methyl-1-benzofuran-3-yl]methylamino]methyl (E)-3-(4-oxo-1,2,3,5-tetrahydropyrido[2,3-b][1,4]diazepin-8-yl)prop-2-enoate |
| SMILES | Cc1oc2c(Oc3ccc(C#N)cc3)cccc2c1CNCOC(=O)/C=C/c1cnc2c(c1)NCCC(=O)N2 |
| InChI | InChI=1S/C29H25N5O5/c1-18-23(22-3-2-4-25(28(22)38-18)39-21-8-5-19(14-30)6-9-21)16-31-17-37-27(36)10-7-20-13-24-29(33-15-20)34-26(35)11-12-32-24/h2-10,13,15,31-32H,11-12,16-17H2,1H3,(H,33,34,35)/b10-7+ |
| InChIKey | ONVGYAHXIKPNEM-JXMROGBWSA-N |
| XLogP | 4.86 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|