About 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole
2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole (PubChem CID 146609719) has the molecular formula C8H15NS
and a molecular weight of 157.28 g/mol. Its IUPAC name is 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole |
| PubChem CID | 146609719 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole |
| SMILES | CCC1NC(C(C)C)=CS1 |
| InChI | InChI=1S/C8H15NS/c1-4-8-9-7(5-10-8)6(2)3/h5-6,8-9H,4H2,1-3H3 |
| InChIKey | CUOFLZSCNJCTBL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole?
The IUPAC name of 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole (CID 146609719) is 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole.
What is the SMILES notation for 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole?
The canonical SMILES for 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole is CCC1NC(C(C)C)=CS1.
What is the InChIKey of 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole?
The InChIKey is CUOFLZSCNJCTBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NS/c1-4-8-9-7(5-10-8)6(2)3/h5-6,8-9H,4H2,1-3H3.
What are the key properties of 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole?
2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole has a molecular weight of 157.28 g/mol, XLogP of 2.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-propan-2-yl-2,3-dihydro-1,3-thiazole is sourced from PubChem (CID 146609719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).