C31H45NO4 — CID 146609873
(2R,4aS,6aR,6aS,14aS,14bR)-11-hydroxy-10-(2-hydroxyethoxy)-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,11,13,14,14b-octahydro-1H-picene-2-carboxamide (PubChem CID 146609873) has the molecular formula C31H45NO4 and a molecular weight of 495.70 g/mol. Its IUPAC name is (2R,4aS,6aR,6aS,14aS,14bR)-11-hydroxy-10-(2-hydroxyethoxy)-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,11,13,14,14b-octahydro-1H-picene-2-carboxamide.
| Compound Name | (2R,4aS,6aR,6aS,14aS,14bR)-11-hydroxy-10-(2-hydroxyethoxy)-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,11,13,14,14b-octahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 146609873 |
| Molecular Formula | C31H45NO4 |
| Molecular Weight | 495.70 g/mol |
| Exact Mass | 495.33 |
| IUPAC Name | (2R,4aS,6aR,6aS,14aS,14bR)-11-hydroxy-10-(2-hydroxyethoxy)-2,4a,6a,6a,9,14a-hexamethyl-3,4,5,6,11,13,14,14b-octahydro-1H-picene-2-carboxamide |
| SMILES | CC1=C(OCCO)C(O)C=C2C1=CC=C1[C@@]2(C)CC[C@@]2(C)[C@@H]3C[C@](C)(C(N)=O)CC[C@]3(C)CC[C@]12C |
| InChI | InChI=1S/C31H45NO4/c1-19-20-7-8-23-29(4,21(20)17-22(34)25(19)36-16-15-33)12-14-31(6)24-18-28(3,26(32)35)10-9-27(24,2)11-13-30(23,31)5/h7-8,17,22,24,33-34H,9-16,18H2,1-6H3,(H2,32,35)/t22?,24-,27-,28-,29+,30-,31+/m1/s1 |
| InChIKey | PPQODNNEPPTXFY-KTGJDAKASA-N |
| XLogP | 5.34 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.70 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |