C24H30FN7O2 — CID 146610183
1-[4-[7-(3-amino-2-methanimidoyl-5,6-dimethylphenyl)-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one (PubChem CID 146610183) has the molecular formula C24H30FN7O2 and a molecular weight of 467.55 g/mol. Its IUPAC name is 1-[4-[7-(3-amino-2-methanimidoyl-5,6-dimethylphenyl)-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one.
| Compound Name | 1-[4-[7-(3-amino-2-methanimidoyl-5,6-dimethylphenyl)-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
|---|---|
| PubChem CID | 146610183 |
| Molecular Formula | C24H30FN7O2 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 1-[4-[7-(3-amino-2-methanimidoyl-5,6-dimethylphenyl)-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-2-fluoroprop-2-en-1-one |
| SMILES | [H]/N=C/c1c(N)cc(C)c(C)c1N1CCc2c(nc(OC)nc2N2CCN(C(=O)C(=C)F)CC2)C1 |
| InChI | InChI=1S/C24H30FN7O2/c1-14-11-19(27)18(12-26)21(15(14)2)32-6-5-17-20(13-32)28-24(34-4)29-22(17)30-7-9-31(10-8-30)23(33)16(3)25/h11-12,26H,3,5-10,13,27H2,1-2,4H3/b26-12+ |
| InChIKey | BCVNVBHHMNDZQC-RPPGKUMJSA-N |
| XLogP | 2.38 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|