About 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride
2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride (PubChem CID 146611140) has the molecular formula C8H12ClNO2S2
and a molecular weight of 253.78 g/mol. Its IUPAC name is 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride |
| PubChem CID | 146611140 |
| Molecular Formula | C8H12ClNO2S2 |
| Molecular Weight | 253.78 g/mol |
| Exact Mass | 253.00 |
| IUPAC Name | 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride |
| SMILES | CCC(C)(C)c1ncc(S(=O)(=O)Cl)s1 |
| InChI | InChI=1S/C8H12ClNO2S2/c1-4-8(2,3)7-10-5-6(13-7)14(9,11)12/h5H,4H2,1-3H3 |
| InChIKey | KLCYLWQTZFAENF-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride?
The IUPAC name of 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride (CID 146611140) is 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride.
What is the SMILES notation for 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride?
The canonical SMILES for 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride is CCC(C)(C)c1ncc(S(=O)(=O)Cl)s1.
What is the InChIKey of 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride?
The InChIKey is KLCYLWQTZFAENF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12ClNO2S2/c1-4-8(2,3)7-10-5-6(13-7)14(9,11)12/h5H,4H2,1-3H3.
What are the key properties of 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride?
2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride has a molecular weight of 253.78 g/mol, XLogP of 2.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylbutan-2-yl)-1,3-thiazole-5-sulfonyl chloride is sourced from PubChem (CID 146611140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).