C21H28N4O2S — CID 146611256
[[amino-oxo-(6-propan-2-yl-3-pyridinyl)-λ6-sulfanylidene]amino]-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methanol (PubChem CID 146611256) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is [[amino-oxo-(6-propan-2-yl-3-pyridinyl)-λ6-sulfanylidene]amino]-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methanol.
| Compound Name | [[amino-oxo-(6-propan-2-yl-3-pyridinyl)-λ6-sulfanylidene]amino]-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methanol |
|---|---|
| PubChem CID | 146611256 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | [[amino-oxo-(6-propan-2-yl-3-pyridinyl)-λ6-sulfanylidene]amino]-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methanol |
| SMILES | CC(C)c1ccc(S(N)(=O)=NC(O)Nc2c3c(cc4c2CCC4)CCC3)cn1 |
| InChI | InChI=1S/C21H28N4O2S/c1-13(2)19-10-9-16(12-23-19)28(22,27)25-21(26)24-20-17-7-3-5-14(17)11-15-6-4-8-18(15)20/h9-13,21,24,26H,3-8H2,1-2H3,(H2,22,25,27) |
| InChIKey | WEJHPUMKIGZPLT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|