C30H30ClF3N6O3 — CID 146611733
tert-butyl 4-[3-[3-chloro-6-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-1,5-naphthyridin-4-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate (PubChem CID 146611733) has the molecular formula C30H30ClF3N6O3 and a molecular weight of 615.06 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-chloro-6-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-1,5-naphthyridin-4-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-chloro-6-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-1,5-naphthyridin-4-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146611733 |
| Molecular Formula | C30H30ClF3N6O3 |
| Molecular Weight | 615.06 g/mol |
| Exact Mass | 614.20 |
| IUPAC Name | tert-butyl 4-[3-[3-chloro-6-[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-1,5-naphthyridin-4-yl]-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2nc(-c3c(Cl)cnc4ccc(N5C[C@@H](F)C[C@@H]5c5cc(F)ccc5F)nc34)no2)CC1 |
| InChI | InChI=1S/C30H30ClF3N6O3/c1-30(2,3)42-29(41)39-10-8-16(9-11-39)28-37-27(38-43-28)25-20(31)14-35-22-6-7-24(36-26(22)25)40-15-18(33)13-23(40)19-12-17(32)4-5-21(19)34/h4-7,12,14,16,18,23H,8-11,13,15H2,1-3H3/t18-,23+/m0/s1 |
| InChIKey | TXZPONROPXCFHM-FDDCHVKYSA-N |
| XLogP | 7.02 |
| TPSA | 97.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.06 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |